C29H39NO4S — CID 91895587
6-[2-(4-aminophenyl)ethyl]-3-[2-tert-butyl-4-(hydroxymethyl)-5-methylphenyl]sulfanyl-6-(2-methylpropyl)oxane-2,4-dione (PubChem CID 91895587) has the molecular formula C29H39NO4S and a molecular weight of 497.70 g/mol. Its IUPAC name is 6-[2-(4-aminophenyl)ethyl]-3-[2-tert-butyl-4-(hydroxymethyl)-5-methylphenyl]sulfanyl-6-(2-methylpropyl)oxane-2,4-dione.
| Compound Name | 6-[2-(4-aminophenyl)ethyl]-3-[2-tert-butyl-4-(hydroxymethyl)-5-methylphenyl]sulfanyl-6-(2-methylpropyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 91895587 |
| Molecular Formula | C29H39NO4S |
| Molecular Weight | 497.70 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 6-[2-(4-aminophenyl)ethyl]-3-[2-tert-butyl-4-(hydroxymethyl)-5-methylphenyl]sulfanyl-6-(2-methylpropyl)oxane-2,4-dione |
| SMILES | Cc1cc(SC2C(=O)CC(CCc3ccc(N)cc3)(CC(C)C)OC2=O)c(C(C)(C)C)cc1CO |
| InChI | InChI=1S/C29H39NO4S/c1-18(2)15-29(12-11-20-7-9-22(30)10-8-20)16-24(32)26(27(33)34-29)35-25-13-19(3)21(17-31)14-23(25)28(4,5)6/h7-10,13-14,18,26,31H,11-12,15-17,30H2,1-6H3 |
| InChIKey | TZRNUGZQSVMZOU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.70 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|