C30H33NO3S — CID 54003207
6-[2-(4-aminophenyl)ethyl]-3-(2-tert-butyl-5-methylphenyl)sulfanyl-6-phenyloxane-2,4-dione (PubChem CID 54003207) has the molecular formula C30H33NO3S and a molecular weight of 487.67 g/mol. Its IUPAC name is 6-[2-(4-aminophenyl)ethyl]-3-(2-tert-butyl-5-methylphenyl)sulfanyl-6-phenyloxane-2,4-dione.
| Compound Name | 6-[2-(4-aminophenyl)ethyl]-3-(2-tert-butyl-5-methylphenyl)sulfanyl-6-phenyloxane-2,4-dione |
|---|---|
| PubChem CID | 54003207 |
| Molecular Formula | C30H33NO3S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 6-[2-(4-aminophenyl)ethyl]-3-(2-tert-butyl-5-methylphenyl)sulfanyl-6-phenyloxane-2,4-dione |
| SMILES | Cc1ccc(C(C)(C)C)c(SC2C(=O)CC(CCc3ccc(N)cc3)(c3ccccc3)OC2=O)c1 |
| InChI | InChI=1S/C30H33NO3S/c1-20-10-15-24(29(2,3)4)26(18-20)35-27-25(32)19-30(34-28(27)33,22-8-6-5-7-9-22)17-16-21-11-13-23(31)14-12-21/h5-15,18,27H,16-17,19,31H2,1-4H3 |
| InChIKey | KNBFHZSPLKBZSN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|