About 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine
4-(oct-7-enylideneamino)nona-1,8-dien-5-amine (PubChem CID 57271448) has the molecular formula C17H30N2
and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine.
Molecular Properties
| Compound Name | 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine |
| PubChem CID | 57271448 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine |
| SMILES | C=CCCCCC/C=N/C(CC=C)C(N)CCC=C |
| InChI | InChI=1S/C17H30N2/c1-4-7-9-10-11-12-15-19-17(13-6-3)16(18)14-8-5-2/h4-6,15-17H,1-3,7-14,18H2/b19-15+ |
| InChIKey | IQYSMQJLTIFDGY-XDJHFCHBSA-N |
| XLogP | 4.43 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine?
The IUPAC name of 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine (CID 57271448) is 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine.
What is the SMILES notation for 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine?
The canonical SMILES for 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine is C=CCCCCC/C=N/C(CC=C)C(N)CCC=C.
What is the InChIKey of 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine?
The InChIKey is IQYSMQJLTIFDGY-XDJHFCHBSA-N. The full InChI is InChI=1S/C17H30N2/c1-4-7-9-10-11-12-15-19-17(13-6-3)16(18)14-8-5-2/h4-6,15-17H,1-3,7-14,18H2/b19-15+.
What are the key properties of 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine?
4-(oct-7-enylideneamino)nona-1,8-dien-5-amine has a molecular weight of 262.44 g/mol, XLogP of 4.43, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oct-7-enylideneamino)nona-1,8-dien-5-amine is sourced from PubChem (CID 57271448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).