About 1-(propylideneamino)octa-6,7-dien-4-amine
1-(propylideneamino)octa-6,7-dien-4-amine (PubChem CID 57011321) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-(propylideneamino)octa-6,7-dien-4-amine.
Molecular Properties
| Compound Name | 1-(propylideneamino)octa-6,7-dien-4-amine |
| PubChem CID | 57011321 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-(propylideneamino)octa-6,7-dien-4-amine |
| SMILES | C=C=CCC(N)CCC/N=C/CC |
| InChI | InChI=1S/C11H20N2/c1-3-5-7-11(12)8-6-10-13-9-4-2/h5,9,11H,1,4,6-8,10,12H2,2H3/b13-9+ |
| InChIKey | XVFYOBGFPOTNOP-UKTHLTGXSA-N |
| XLogP | 2.31 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(propylideneamino)octa-6,7-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(propylideneamino)octa-6,7-dien-4-amine?
The IUPAC name of 1-(propylideneamino)octa-6,7-dien-4-amine (CID 57011321) is 1-(propylideneamino)octa-6,7-dien-4-amine.
What is the SMILES notation for 1-(propylideneamino)octa-6,7-dien-4-amine?
The canonical SMILES for 1-(propylideneamino)octa-6,7-dien-4-amine is C=C=CCC(N)CCC/N=C/CC.
What is the InChIKey of 1-(propylideneamino)octa-6,7-dien-4-amine?
The InChIKey is XVFYOBGFPOTNOP-UKTHLTGXSA-N. The full InChI is InChI=1S/C11H20N2/c1-3-5-7-11(12)8-6-10-13-9-4-2/h5,9,11H,1,4,6-8,10,12H2,2H3/b13-9+.
What are the key properties of 1-(propylideneamino)octa-6,7-dien-4-amine?
1-(propylideneamino)octa-6,7-dien-4-amine has a molecular weight of 180.29 g/mol, XLogP of 2.31, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(propylideneamino)octa-6,7-dien-4-amine is sourced from PubChem (CID 57011321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).