C10H18N2 — CID 163904487
5-ethyliminoocta-6,7-dien-3-amine (PubChem CID 163904487) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 5-ethyliminoocta-6,7-dien-3-amine.
| Compound Name | 5-ethyliminoocta-6,7-dien-3-amine |
|---|---|
| PubChem CID | 163904487 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 5-ethyliminoocta-6,7-dien-3-amine |
| SMILES | C=C=C/C(CC(N)CC)=N\CC |
| InChI | InChI=1S/C10H18N2/c1-4-7-10(12-6-3)8-9(11)5-2/h7,9H,1,5-6,8,11H2,2-3H3/b12-10+ |
| InChIKey | QMTDXYVVYNNSRB-ZRDIBKRKSA-N |
| XLogP | 1.92 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|