About 3-iminonona-1,7,8-trien-4-amine
3-iminonona-1,7,8-trien-4-amine (PubChem CID 90802406) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-iminonona-1,7,8-trien-4-amine.
Molecular Properties
| Compound Name | 3-iminonona-1,7,8-trien-4-amine |
| PubChem CID | 90802406 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3-iminonona-1,7,8-trien-4-amine |
| SMILES | [H]/N=C(\C=C)C(N)CCC=C=C |
| InChI | InChI=1S/C9H14N2/c1-3-5-6-7-9(11)8(10)4-2/h4-5,9-10H,1-2,6-7,11H2/b10-8+ |
| InChIKey | GZINFGJPZKZKMI-CSKARUKUSA-N |
| XLogP | 1.64 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminonona-1,7,8-trien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminonona-1,7,8-trien-4-amine?
The IUPAC name of 3-iminonona-1,7,8-trien-4-amine (CID 90802406) is 3-iminonona-1,7,8-trien-4-amine.
What is the SMILES notation for 3-iminonona-1,7,8-trien-4-amine?
The canonical SMILES for 3-iminonona-1,7,8-trien-4-amine is [H]/N=C(\C=C)C(N)CCC=C=C.
What is the InChIKey of 3-iminonona-1,7,8-trien-4-amine?
The InChIKey is GZINFGJPZKZKMI-CSKARUKUSA-N. The full InChI is InChI=1S/C9H14N2/c1-3-5-6-7-9(11)8(10)4-2/h4-5,9-10H,1-2,6-7,11H2/b10-8+.
What are the key properties of 3-iminonona-1,7,8-trien-4-amine?
3-iminonona-1,7,8-trien-4-amine has a molecular weight of 150.22 g/mol, XLogP of 1.64, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminonona-1,7,8-trien-4-amine is sourced from PubChem (CID 90802406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).