About 5-iminohept-6-en-2-amine
5-iminohept-6-en-2-amine (PubChem CID 123625298) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 5-iminohept-6-en-2-amine.
Molecular Properties
| Compound Name | 5-iminohept-6-en-2-amine |
| PubChem CID | 123625298 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 5-iminohept-6-en-2-amine |
| SMILES | [H]/N=C(\C=C)CCC(C)N |
| InChI | InChI=1S/C7H14N2/c1-3-7(9)5-4-6(2)8/h3,6,9H,1,4-5,8H2,2H3/b9-7+ |
| InChIKey | NUVWBZMFDLKPIW-VQHVLOKHSA-N |
| XLogP | 1.32 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iminohept-6-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminohept-6-en-2-amine?
The IUPAC name of 5-iminohept-6-en-2-amine (CID 123625298) is 5-iminohept-6-en-2-amine.
What is the SMILES notation for 5-iminohept-6-en-2-amine?
The canonical SMILES for 5-iminohept-6-en-2-amine is [H]/N=C(\C=C)CCC(C)N.
What is the InChIKey of 5-iminohept-6-en-2-amine?
The InChIKey is NUVWBZMFDLKPIW-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H14N2/c1-3-7(9)5-4-6(2)8/h3,6,9H,1,4-5,8H2,2H3/b9-7+.
What are the key properties of 5-iminohept-6-en-2-amine?
5-iminohept-6-en-2-amine has a molecular weight of 126.20 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminohept-6-en-2-amine is sourced from PubChem (CID 123625298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).