About 4-nitro-3H-pyridin-2-one
4-nitro-3H-pyridin-2-one (PubChem CID 57271645) has the molecular formula C5H4N2O3
and a molecular weight of 140.10 g/mol. Its IUPAC name is 4-nitro-3H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-nitro-3H-pyridin-2-one |
| PubChem CID | 57271645 |
| Molecular Formula | C5H4N2O3 |
| Molecular Weight | 140.10 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | 4-nitro-3H-pyridin-2-one |
| SMILES | O=C1CC([N+](=O)[O-])=CC=N1 |
| InChI | InChI=1S/C5H4N2O3/c8-5-3-4(7(9)10)1-2-6-5/h1-2H,3H2 |
| InChIKey | BSAHZCYSRULRRU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.10 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-3H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-3H-pyridin-2-one?
The IUPAC name of 4-nitro-3H-pyridin-2-one (CID 57271645) is 4-nitro-3H-pyridin-2-one.
What is the SMILES notation for 4-nitro-3H-pyridin-2-one?
The canonical SMILES for 4-nitro-3H-pyridin-2-one is O=C1CC([N+](=O)[O-])=CC=N1.
What is the InChIKey of 4-nitro-3H-pyridin-2-one?
The InChIKey is BSAHZCYSRULRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O3/c8-5-3-4(7(9)10)1-2-6-5/h1-2H,3H2.
What are the key properties of 4-nitro-3H-pyridin-2-one?
4-nitro-3H-pyridin-2-one has a molecular weight of 140.10 g/mol, XLogP of 0.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-3H-pyridin-2-one is sourced from PubChem (CID 57271645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).