About 4-Nitro-1-oxido-2,3-dihydropyridin-1-ium
4-Nitro-1-oxido-2,3-dihydropyridin-1-ium (PubChem CID 89134134) has the molecular formula C5H6N2O3
and a molecular weight of 142.11 g/mol. Its IUPAC name is 4-nitro-1-oxido-2,3-dihydropyridin-1-ium.
Molecular Properties
| Compound Name | 4-Nitro-1-oxido-2,3-dihydropyridin-1-ium |
| PubChem CID | 89134134 |
| Molecular Formula | C5H6N2O3 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 4-nitro-1-oxido-2,3-dihydropyridin-1-ium |
| SMILES | C1C[N+](=CC=C1[N+](=O)[O-])[O-] |
| InChI | InChI=1S/C5H6N2O3/c8-6-3-1-5(2-4-6)7(9)10/h1,3H,2,4H2 |
| InChIKey | YIDCLZTXASBQQG-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | 213 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-Nitro-1-oxido-2,3-dihydropyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Nitro-1-oxido-2,3-dihydropyridin-1-ium?
The IUPAC name of 4-Nitro-1-oxido-2,3-dihydropyridin-1-ium (CID 89134134) is 4-nitro-1-oxido-2,3-dihydropyridin-1-ium.
What is the SMILES notation for 4-Nitro-1-oxido-2,3-dihydropyridin-1-ium?
The canonical SMILES for 4-Nitro-1-oxido-2,3-dihydropyridin-1-ium is C1C[N+](=CC=C1[N+](=O)[O-])[O-].
What is the InChIKey of 4-Nitro-1-oxido-2,3-dihydropyridin-1-ium?
The InChIKey is YIDCLZTXASBQQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3/c8-6-3-1-5(2-4-6)7(9)10/h1,3H,2,4H2.
What are the key properties of 4-Nitro-1-oxido-2,3-dihydropyridin-1-ium?
4-Nitro-1-oxido-2,3-dihydropyridin-1-ium has a molecular weight of 142.11 g/mol, XLogP of -1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Nitro-1-oxido-2,3-dihydropyridin-1-ium is sourced from PubChem (CID 89134134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).