About 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium
2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium (PubChem CID 45382144) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium.
Molecular Properties
| Compound Name | 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium |
| PubChem CID | 45382144 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium |
| SMILES | CC1C([N+](=O)[O-])=CC=[N+]([O-])C1C |
| InChI | InChI=1S/C7H10N2O3/c1-5-6(2)8(10)4-3-7(5)9(11)12/h3-6H,1-2H3 |
| InChIKey | QVISJQOGXLMQHV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium?
The IUPAC name of 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium (CID 45382144) is 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium.
What is the SMILES notation for 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium?
The canonical SMILES for 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium is CC1C([N+](=O)[O-])=CC=[N+]([O-])C1C.
What is the InChIKey of 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium?
The InChIKey is QVISJQOGXLMQHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-5-6(2)8(10)4-3-7(5)9(11)12/h3-6H,1-2H3.
What are the key properties of 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium?
2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium has a molecular weight of 170.17 g/mol, XLogP of 0.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4-nitro-1-oxido-2,3-dihydropyridin-1-ium is sourced from PubChem (CID 45382144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).