C13H17N3O7 — CID 57276390
5-(3,4-dihydroxybut-1-ynyl)-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carboxamide (PubChem CID 57276390) has the molecular formula C13H17N3O7 and a molecular weight of 327.29 g/mol. Its IUPAC name is 5-(3,4-dihydroxybut-1-ynyl)-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carboxamide.
| Compound Name | 5-(3,4-dihydroxybut-1-ynyl)-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 57276390 |
| Molecular Formula | C13H17N3O7 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 5-(3,4-dihydroxybut-1-ynyl)-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carboxamide |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1C#CC(O)CO |
| InChI | InChI=1S/C13H17N3O7/c14-12(22)9-7(2-1-6(19)3-17)16(5-15-9)13-11(21)10(20)8(4-18)23-13/h5-6,8,10-11,13,17-21H,3-4H2,(H2,14,22)/t6?,8-,10-,11-,13-/m1/s1 |
| InChIKey | AIFPLAMBIMGVTG-AFPHGCNRSA-N |
| XLogP | -3.70 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|