C19H21N3O5 — CID 46876966
1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-phenylbut-1-ynyl)imidazole-4-carboxamide (PubChem CID 46876966) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-phenylbut-1-ynyl)imidazole-4-carboxamide.
| Compound Name | 1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-phenylbut-1-ynyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 46876966 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-phenylbut-1-ynyl)imidazole-4-carboxamide |
| SMILES | NC(=O)c1ncn(C2O[C@H](CO)[C@@H](O)[C@H]2O)c1C#CCCc1ccccc1 |
| InChI | InChI=1S/C19H21N3O5/c20-18(26)15-13(9-5-4-8-12-6-2-1-3-7-12)22(11-21-15)19-17(25)16(24)14(10-23)27-19/h1-3,6-7,11,14,16-17,19,23-25H,4,8,10H2,(H2,20,26)/t14-,16-,17-,19?/m1/s1 |
| InChIKey | ZYEFYNLWZFMIFX-BSPZJRRFSA-N |
| XLogP | -0.42 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|