C20H26N4O8 — CID 159814452
[(2R,3S,4R,5R)-5-(4-carbamoyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,3R)-2-amino-3-phenylmethoxybutanoate (PubChem CID 159814452) has the molecular formula C20H26N4O8 and a molecular weight of 450.45 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-carbamoyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,3R)-2-amino-3-phenylmethoxybutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-carbamoyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,3R)-2-amino-3-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 159814452 |
| Molecular Formula | C20H26N4O8 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-carbamoyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,3R)-2-amino-3-phenylmethoxybutanoate |
| SMILES | C[C@@H](OCc1ccccc1)[C@H](N)C(=O)OC[C@H]1O[C@@H](n2cnc(C(N)=O)c2O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H26N4O8/c1-10(30-7-11-5-3-2-4-6-11)13(21)20(29)31-8-12-15(25)16(26)19(32-12)24-9-23-14(17(22)27)18(24)28/h2-6,9-10,12-13,15-16,19,25-26,28H,7-8,21H2,1H3,(H2,22,27)/t10-,12-,13+,15-,16-,19-/m1/s1 |
| InChIKey | NLKZEIWWUJYPMK-JXBMMRTCSA-N |
| XLogP | -1.22 |
| TPSA | 192.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |