C30H27Cl2NO5S — CID 57278077
3-[1-(2-carboxypropylsulfanyl)-1-chloro-1-[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]propan-2-yl]benzoic acid (PubChem CID 57278077) has the molecular formula C30H27Cl2NO5S and a molecular weight of 584.52 g/mol. Its IUPAC name is 3-[1-(2-carboxypropylsulfanyl)-1-chloro-1-[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]propan-2-yl]benzoic acid.
| Compound Name | 3-[1-(2-carboxypropylsulfanyl)-1-chloro-1-[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]propan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 57278077 |
| Molecular Formula | C30H27Cl2NO5S |
| Molecular Weight | 584.52 g/mol |
| Exact Mass | 583.10 |
| IUPAC Name | 3-[1-(2-carboxypropylsulfanyl)-1-chloro-1-[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]propan-2-yl]benzoic acid |
| SMILES | CC(CSC(Cl)(c1cccc(OCc2ccc3ccc(Cl)cc3n2)c1)C(C)c1cccc(C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C30H27Cl2NO5S/c1-18(28(34)35)17-39-30(32,19(2)21-5-3-6-22(13-21)29(36)37)23-7-4-8-26(14-23)38-16-25-12-10-20-9-11-24(31)15-27(20)33-25/h3-15,18-19H,16-17H2,1-2H3,(H,34,35)(H,36,37) |
| InChIKey | BRYIOYGGHTWMEP-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.52 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|