About 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile
9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile (PubChem CID 57278307) has the molecular formula C17H30N2O2
and a molecular weight of 294.44 g/mol. Its IUPAC name is 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile.
Molecular Properties
| Compound Name | 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile |
| PubChem CID | 57278307 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile |
| SMILES | CCCCN(C)C1(C#N)CCC2(CC1)OCC(C)(C)CO2 |
| InChI | InChI=1S/C17H30N2O2/c1-5-6-11-19(4)16(12-18)7-9-17(10-8-16)20-13-15(2,3)14-21-17/h5-11,13-14H2,1-4H3 |
| InChIKey | JYLXSXVHCRNAKL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile?
The IUPAC name of 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile (CID 57278307) is 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile.
What is the SMILES notation for 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile?
The canonical SMILES for 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile is CCCCN(C)C1(C#N)CCC2(CC1)OCC(C)(C)CO2.
What is the InChIKey of 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile?
The InChIKey is JYLXSXVHCRNAKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O2/c1-5-6-11-19(4)16(12-18)7-9-17(10-8-16)20-13-15(2,3)14-21-17/h5-11,13-14H2,1-4H3.
What are the key properties of 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile?
9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile has a molecular weight of 294.44 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[butyl(methyl)amino]-3,3-dimethyl-1,5-dioxaspiro[5.5]undecane-9-carbonitrile is sourced from PubChem (CID 57278307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).