C24H29N3O8 — CID 57279865
ethyl 6,7-dimethoxy-4-[methoxycarbonyl-[(4-nitrophenyl)methyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 57279865) has the molecular formula C24H29N3O8 and a molecular weight of 487.51 g/mol. Its IUPAC name is ethyl 6,7-dimethoxy-4-[methoxycarbonyl-[(4-nitrophenyl)methyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | ethyl 6,7-dimethoxy-4-[methoxycarbonyl-[(4-nitrophenyl)methyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 57279865 |
| Molecular Formula | C24H29N3O8 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | ethyl 6,7-dimethoxy-4-[methoxycarbonyl-[(4-nitrophenyl)methyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2cc(OC)c(OC)cc2C(N(Cc2ccc([N+](=O)[O-])cc2)C(=O)OC)CC1C |
| InChI | InChI=1S/C24H29N3O8/c1-6-35-24(29)26-15(2)11-19(18-12-21(32-3)22(33-4)13-20(18)26)25(23(28)34-5)14-16-7-9-17(10-8-16)27(30)31/h7-10,12-13,15,19H,6,11,14H2,1-5H3 |
| InChIKey | PMYXZRVPGPMUGW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 120.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|