C14H28N2O4 — CID 57280525
2-(1-acetamido-1-hydroxyethyl)-N-(2-hydroxyethyl)-2-propylpentanamide (PubChem CID 57280525) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(1-acetamido-1-hydroxyethyl)-N-(2-hydroxyethyl)-2-propylpentanamide.
| Compound Name | 2-(1-acetamido-1-hydroxyethyl)-N-(2-hydroxyethyl)-2-propylpentanamide |
|---|---|
| PubChem CID | 57280525 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-(1-acetamido-1-hydroxyethyl)-N-(2-hydroxyethyl)-2-propylpentanamide |
| SMILES | CCCC(CCC)(C(=O)NCCO)C(C)(O)NC(C)=O |
| InChI | InChI=1S/C14H28N2O4/c1-5-7-14(8-6-2,12(19)15-9-10-17)13(4,20)16-11(3)18/h17,20H,5-10H2,1-4H3,(H,15,19)(H,16,18) |
| InChIKey | DWWPAWYKKINIPG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|