C21H29BrN2O2 — CID 57285663
6-[(4-bromophenyl)methylidene]-2-methyl-N-(3-morpholin-4-ylpropoxy)cyclohexen-1-amine (PubChem CID 57285663) has the molecular formula C21H29BrN2O2 and a molecular weight of 421.38 g/mol. Its IUPAC name is 6-[(4-bromophenyl)methylidene]-2-methyl-N-(3-morpholin-4-ylpropoxy)cyclohexen-1-amine.
| Compound Name | 6-[(4-bromophenyl)methylidene]-2-methyl-N-(3-morpholin-4-ylpropoxy)cyclohexen-1-amine |
|---|---|
| PubChem CID | 57285663 |
| Molecular Formula | C21H29BrN2O2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 6-[(4-bromophenyl)methylidene]-2-methyl-N-(3-morpholin-4-ylpropoxy)cyclohexen-1-amine |
| SMILES | CC1=C(NOCCCN2CCOCC2)C(=Cc2ccc(Br)cc2)CCC1 |
| InChI | InChI=1S/C21H29BrN2O2/c1-17-4-2-5-19(16-18-6-8-20(22)9-7-18)21(17)23-26-13-3-10-24-11-14-25-15-12-24/h6-9,16,23H,2-5,10-15H2,1H3 |
| InChIKey | WZPWVSRHJFSTQC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|