C21H30N2O2 — CID 57303958
6-benzylidene-2-methyl-N-(3-morpholin-4-ylpropoxy)cyclohexen-1-amine (PubChem CID 57303958) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 6-benzylidene-2-methyl-N-(3-morpholin-4-ylpropoxy)cyclohexen-1-amine.
| Compound Name | 6-benzylidene-2-methyl-N-(3-morpholin-4-ylpropoxy)cyclohexen-1-amine |
|---|---|
| PubChem CID | 57303958 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 6-benzylidene-2-methyl-N-(3-morpholin-4-ylpropoxy)cyclohexen-1-amine |
| SMILES | CC1=C(NOCCCN2CCOCC2)C(=Cc2ccccc2)CCC1 |
| InChI | InChI=1S/C21H30N2O2/c1-18-7-5-10-20(17-19-8-3-2-4-9-19)21(18)22-25-14-6-11-23-12-15-24-16-13-23/h2-4,8-9,17,22H,5-7,10-16H2,1H3 |
| InChIKey | ARFANQGFSQLSFR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|