C43H67NO11 — CID 57285751
17-ethyl-1-hydroxy-12-[1-(4-hydroxy-3-methoxycyclohexyl)prop-1-en-2-yl]-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacosa-14,18-diene-2,3,10,16-tetrone (PubChem CID 57285751) has the molecular formula C43H67NO11 and a molecular weight of 774.01 g/mol. Its IUPAC name is 17-ethyl-1-hydroxy-12-[1-(4-hydroxy-3-methoxycyclohexyl)prop-1-en-2-yl]-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacosa-14,18-diene-2,3,10,16-tetrone.
| Compound Name | 17-ethyl-1-hydroxy-12-[1-(4-hydroxy-3-methoxycyclohexyl)prop-1-en-2-yl]-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacosa-14,18-diene-2,3,10,16-tetrone |
|---|---|
| PubChem CID | 57285751 |
| Molecular Formula | C43H67NO11 |
| Molecular Weight | 774.01 g/mol |
| Exact Mass | 773.47 |
| IUPAC Name | 17-ethyl-1-hydroxy-12-[1-(4-hydroxy-3-methoxycyclohexyl)prop-1-en-2-yl]-23,25-dimethoxy-13,19,21,27-tetramethyl-11,28-dioxa-4-azatricyclo[22.3.1.04,9]octacosa-14,18-diene-2,3,10,16-tetrone |
| SMILES | CCC1C=C(C)CC(C)CC(OC)C2OC(O)(C(=O)C(=O)N3CCCCC3C(=O)OC(C(C)=CC3CCC(O)C(OC)C3)C(C)C=CC1=O)C(C)CC2OC |
| InChI | InChI=1S/C43H67NO11/c1-10-31-20-25(2)19-26(3)21-36(52-8)39-37(53-9)23-29(6)43(50,55-39)40(47)41(48)44-18-12-11-13-32(44)42(49)54-38(27(4)14-16-33(31)45)28(5)22-30-15-17-34(46)35(24-30)51-7/h14,16,20,22,26-27,29-32,34-39,46,50H,10-13,15,17-19,21,23-24H2,1-9H3 |
| InChIKey | FAAQOZGECBNKHR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.01 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|