C6H7N3O3S — CID 57286020
(5-amino-2-methylsulfanylpyrimidin-4-yl) hydrogen carbonate (PubChem CID 57286020) has the molecular formula C6H7N3O3S and a molecular weight of 201.21 g/mol. Its IUPAC name is (5-amino-2-methylsulfanylpyrimidin-4-yl) hydrogen carbonate.
| Compound Name | (5-amino-2-methylsulfanylpyrimidin-4-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 57286020 |
| Molecular Formula | C6H7N3O3S |
| Molecular Weight | 201.21 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | (5-amino-2-methylsulfanylpyrimidin-4-yl) hydrogen carbonate |
| SMILES | CSc1ncc(N)c(OC(=O)O)n1 |
| InChI | InChI=1S/C6H7N3O3S/c1-13-5-8-2-3(7)4(9-5)12-6(10)11/h2H,7H2,1H3,(H,10,11) |
| InChIKey | KXMWOTLQTSWDOM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |