C8H14N4O3S — CID 172808365
4-amino-2-methylsulfanylpyrimidine-5-carboxylic acid;N-methoxymethanamine (PubChem CID 172808365) has the molecular formula C8H14N4O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is 4-amino-2-methylsulfanylpyrimidine-5-carboxylic acid;N-methoxymethanamine.
| Compound Name | 4-amino-2-methylsulfanylpyrimidine-5-carboxylic acid;N-methoxymethanamine |
|---|---|
| PubChem CID | 172808365 |
| Molecular Formula | C8H14N4O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-amino-2-methylsulfanylpyrimidine-5-carboxylic acid;N-methoxymethanamine |
| SMILES | CNOC.CSc1ncc(C(=O)O)c(N)n1 |
| InChI | InChI=1S/C6H7N3O2S.C2H7NO/c1-12-6-8-2-3(5(10)11)4(7)9-6;1-3-4-2/h2H,1H3,(H,10,11)(H2,7,8,9);3H,1-2H3 |
| InChIKey | RVCYHYFDWJSZGD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|