C10H17NO5 — CID 57286446
2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-5-hydroxypent-3-enoic acid (PubChem CID 57286446) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-5-hydroxypent-3-enoic acid.
| Compound Name | 2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-5-hydroxypent-3-enoic acid |
|---|---|
| PubChem CID | 57286446 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-5-hydroxypent-3-enoic acid |
| SMILES | CC(C)(C)ON(C=O)C(C=CCO)C(=O)O |
| InChI | InChI=1S/C10H17NO5/c1-10(2,3)16-11(7-13)8(9(14)15)5-4-6-12/h4-5,7-8,12H,6H2,1-3H3,(H,14,15) |
| InChIKey | CVMZXXNIRWJHSU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|