C14H27Br2N2O6P — CID 56989822
N-[bromo-[[bromo-[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-ethoxyphosphoryl]methyl]-N-[(2-methylpropan-2-yl)oxy]formamide (PubChem CID 56989822) has the molecular formula C14H27Br2N2O6P and a molecular weight of 510.16 g/mol. Its IUPAC name is N-[bromo-[[bromo-[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-ethoxyphosphoryl]methyl]-N-[(2-methylpropan-2-yl)oxy]formamide.
| Compound Name | N-[bromo-[[bromo-[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-ethoxyphosphoryl]methyl]-N-[(2-methylpropan-2-yl)oxy]formamide |
|---|---|
| PubChem CID | 56989822 |
| Molecular Formula | C14H27Br2N2O6P |
| Molecular Weight | 510.16 g/mol |
| Exact Mass | 508.00 |
| IUPAC Name | N-[bromo-[[bromo-[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-ethoxyphosphoryl]methyl]-N-[(2-methylpropan-2-yl)oxy]formamide |
| SMILES | CCOP(=O)(C(Br)N(C=O)OC(C)(C)C)C(Br)N(C=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27Br2N2O6P/c1-8-22-25(21,11(15)17(9-19)23-13(2,3)4)12(16)18(10-20)24-14(5,6)7/h9-12H,8H2,1-7H3 |
| InChIKey | JNTRNWQXCDUFPM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.16 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|