C9H19NO9P2 — CID 54488806
(2S)-2-[diethoxyphosphoryl(formyl)amino]-2-[ethoxy(hydroxy)phosphoryl]acetic acid (PubChem CID 54488806) has the molecular formula C9H19NO9P2 and a molecular weight of 347.20 g/mol. Its IUPAC name is (2S)-2-[diethoxyphosphoryl(formyl)amino]-2-[ethoxy(hydroxy)phosphoryl]acetic acid.
| Compound Name | (2S)-2-[diethoxyphosphoryl(formyl)amino]-2-[ethoxy(hydroxy)phosphoryl]acetic acid |
|---|---|
| PubChem CID | 54488806 |
| Molecular Formula | C9H19NO9P2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (2S)-2-[diethoxyphosphoryl(formyl)amino]-2-[ethoxy(hydroxy)phosphoryl]acetic acid |
| SMILES | CCOP(=O)(O)[C@@H](C(=O)O)N(C=O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C9H19NO9P2/c1-4-17-20(14,15)8(9(12)13)10(7-11)21(16,18-5-2)19-6-3/h7-8H,4-6H2,1-3H3,(H,12,13)(H,14,15)/t8-/m0/s1 |
| InChIKey | XUHIJBWXUDIERM-QMMMGPOBSA-N |
| XLogP | 1.26 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|