C19H21NO3S2 — CID 57287196
O-(2-phenylethyl) (2S)-1-(benzenesulfonyl)pyrrolidine-2-carbothioate (PubChem CID 57287196) has the molecular formula C19H21NO3S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is O-(2-phenylethyl) (2S)-1-(benzenesulfonyl)pyrrolidine-2-carbothioate.
| Compound Name | O-(2-phenylethyl) (2S)-1-(benzenesulfonyl)pyrrolidine-2-carbothioate |
|---|---|
| PubChem CID | 57287196 |
| Molecular Formula | C19H21NO3S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | O-(2-phenylethyl) (2S)-1-(benzenesulfonyl)pyrrolidine-2-carbothioate |
| SMILES | O=S(=O)(c1ccccc1)N1CCC[C@H]1C(=S)OCCc1ccccc1 |
| InChI | InChI=1S/C19H21NO3S2/c21-25(22,17-10-5-2-6-11-17)20-14-7-12-18(20)19(24)23-15-13-16-8-3-1-4-9-16/h1-6,8-11,18H,7,12-15H2/t18-/m0/s1 |
| InChIKey | ZFXMSSGSIZSPNV-SFHVURJKSA-N |
| XLogP | 3.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|