C11H13Br2NO2S2 — CID 57287504
(3,4-dibromophenyl) N,N-bis(1-sulfanylethyl)carbamate (PubChem CID 57287504) has the molecular formula C11H13Br2NO2S2 and a molecular weight of 415.17 g/mol. Its IUPAC name is (3,4-dibromophenyl) N,N-bis(1-sulfanylethyl)carbamate.
| Compound Name | (3,4-dibromophenyl) N,N-bis(1-sulfanylethyl)carbamate |
|---|---|
| PubChem CID | 57287504 |
| Molecular Formula | C11H13Br2NO2S2 |
| Molecular Weight | 415.17 g/mol |
| Exact Mass | 412.88 |
| IUPAC Name | (3,4-dibromophenyl) N,N-bis(1-sulfanylethyl)carbamate |
| SMILES | CC(S)N(C(=O)Oc1ccc(Br)c(Br)c1)C(C)S |
| InChI | InChI=1S/C11H13Br2NO2S2/c1-6(17)14(7(2)18)11(15)16-8-3-4-9(12)10(13)5-8/h3-7,17-18H,1-2H3 |
| InChIKey | XYBLJUXOVRVNIW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.17 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|