C8H2Br3Cl3N4 — CID 57289897
5-(tribromomethyl)-1-(2,4,6-trichlorophenyl)tetrazole (PubChem CID 57289897) has the molecular formula C8H2Br3Cl3N4 and a molecular weight of 500.20 g/mol. Its IUPAC name is 5-(tribromomethyl)-1-(2,4,6-trichlorophenyl)tetrazole.
| Compound Name | 5-(tribromomethyl)-1-(2,4,6-trichlorophenyl)tetrazole |
|---|---|
| PubChem CID | 57289897 |
| Molecular Formula | C8H2Br3Cl3N4 |
| Molecular Weight | 500.20 g/mol |
| Exact Mass | 495.69 |
| IUPAC Name | 5-(tribromomethyl)-1-(2,4,6-trichlorophenyl)tetrazole |
| SMILES | Clc1cc(Cl)c(-n2nnnc2C(Br)(Br)Br)c(Cl)c1 |
| InChI | InChI=1S/C8H2Br3Cl3N4/c9-8(10,11)7-15-16-17-18(7)6-4(13)1-3(12)2-5(6)14/h1-2H |
| InChIKey | HMABGWZJFWDUQE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.20 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|