C7H4ClF2N5 — CID 83083270
1-(2-chloro-4,6-difluorophenyl)tetrazol-5-amine (PubChem CID 83083270) has the molecular formula C7H4ClF2N5 and a molecular weight of 231.59 g/mol. Its IUPAC name is 1-(2-chloro-4,6-difluorophenyl)tetrazol-5-amine.
| Compound Name | 1-(2-chloro-4,6-difluorophenyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 83083270 |
| Molecular Formula | C7H4ClF2N5 |
| Molecular Weight | 231.59 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | 1-(2-chloro-4,6-difluorophenyl)tetrazol-5-amine |
| SMILES | Nc1nnnn1-c1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C7H4ClF2N5/c8-4-1-3(9)2-5(10)6(4)15-7(11)12-13-14-15/h1-2H,(H2,11,12,14) |
| InChIKey | MFIFMPCRLYLYMD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.59 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |