C8H5ClF2N4S — CID 83087639
3-amino-4-(2-chloro-4,6-difluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 83087639) has the molecular formula C8H5ClF2N4S and a molecular weight of 262.67 g/mol. Its IUPAC name is 3-amino-4-(2-chloro-4,6-difluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-amino-4-(2-chloro-4,6-difluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 83087639 |
| Molecular Formula | C8H5ClF2N4S |
| Molecular Weight | 262.67 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 3-amino-4-(2-chloro-4,6-difluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Nc1n[nH]c(=S)n1-c1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C8H5ClF2N4S/c9-4-1-3(10)2-5(11)6(4)15-7(12)13-14-8(15)16/h1-2H,(H2,12,13)(H,14,16) |
| InChIKey | YLWIKAZOANZFDX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.67 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|