C12H14Cl2N2O5S — CID 57289943
2-chloro-3-chlorosulfanyl-2-[3-(2,5-dihydroxypyrrol-1-yl)-2-oxoazetidin-1-yl]-3-methylbutanoic acid (PubChem CID 57289943) has the molecular formula C12H14Cl2N2O5S and a molecular weight of 369.23 g/mol. Its IUPAC name is 2-chloro-3-chlorosulfanyl-2-[3-(2,5-dihydroxypyrrol-1-yl)-2-oxoazetidin-1-yl]-3-methylbutanoic acid.
| Compound Name | 2-chloro-3-chlorosulfanyl-2-[3-(2,5-dihydroxypyrrol-1-yl)-2-oxoazetidin-1-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 57289943 |
| Molecular Formula | C12H14Cl2N2O5S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 2-chloro-3-chlorosulfanyl-2-[3-(2,5-dihydroxypyrrol-1-yl)-2-oxoazetidin-1-yl]-3-methylbutanoic acid |
| SMILES | CC(C)(SCl)C(Cl)(C(=O)O)N1CC(n2c(O)ccc2O)C1=O |
| InChI | InChI=1S/C12H14Cl2N2O5S/c1-11(2,22-14)12(13,10(20)21)15-5-6(9(15)19)16-7(17)3-4-8(16)18/h3-4,6,17-18H,5H2,1-2H3,(H,20,21) |
| InChIKey | JBQUCCCIDDJOFS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|