C12H13FN2O5 — CID 57319380
2-[3-(2,5-dihydroxypyrrol-1-yl)-2-fluoro-4-oxoazetidin-1-yl]-3-methylbut-2-enoic acid (PubChem CID 57319380) has the molecular formula C12H13FN2O5 and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-[3-(2,5-dihydroxypyrrol-1-yl)-2-fluoro-4-oxoazetidin-1-yl]-3-methylbut-2-enoic acid.
| Compound Name | 2-[3-(2,5-dihydroxypyrrol-1-yl)-2-fluoro-4-oxoazetidin-1-yl]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 57319380 |
| Molecular Formula | C12H13FN2O5 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[3-(2,5-dihydroxypyrrol-1-yl)-2-fluoro-4-oxoazetidin-1-yl]-3-methylbut-2-enoic acid |
| SMILES | CC(C)=C(C(=O)O)N1C(=O)C(n2c(O)ccc2O)C1F |
| InChI | InChI=1S/C12H13FN2O5/c1-5(2)8(12(19)20)15-10(13)9(11(15)18)14-6(16)3-4-7(14)17/h3-4,9-10,16-17H,1-2H3,(H,19,20) |
| InChIKey | UOLKFDZVQJHUHO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|