C9H11N3O4 — CID 54252739
2-(2,5-dihydroxypyrrol-1-yl)-N-(2-oxoazetidin-3-yl)acetamide (PubChem CID 54252739) has the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-oxoazetidin-3-yl)acetamide.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-oxoazetidin-3-yl)acetamide |
|---|---|
| PubChem CID | 54252739 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-oxoazetidin-3-yl)acetamide |
| SMILES | O=C(Cn1c(O)ccc1O)NC1CNC1=O |
| InChI | InChI=1S/C9H11N3O4/c13-6(11-5-3-10-9(5)16)4-12-7(14)1-2-8(12)15/h1-2,5,14-15H,3-4H2,(H,10,16)(H,11,13) |
| InChIKey | QXXLWYYBPFLPRT-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |