C12H25N5O2 — CID 123225679
1-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]pyrrole-2,5-diol (PubChem CID 123225679) has the molecular formula C12H25N5O2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]pyrrole-2,5-diol.
| Compound Name | 1-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123225679 |
| Molecular Formula | C12H25N5O2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]pyrrole-2,5-diol |
| SMILES | NCCNCCNCCNCCn1c(O)ccc1O |
| InChI | InChI=1S/C12H25N5O2/c13-3-4-14-5-6-15-7-8-16-9-10-17-11(18)1-2-12(17)19/h1-2,14-16,18-19H,3-10,13H2 |
| InChIKey | YVWWSNIHVVQTOP-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|