C11H10N2O6 — CID 54288085
(2,5-dihydroxypyrrol-1-yl) 2-(2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 54288085) has the molecular formula C11H10N2O6 and a molecular weight of 266.21 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(2,5-dioxopyrrol-1-yl)propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(2,5-dioxopyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 54288085 |
| Molecular Formula | C11H10N2O6 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | CC(C(=O)On1c(O)ccc1O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H10N2O6/c1-6(12-7(14)2-3-8(12)15)11(18)19-13-9(16)4-5-10(13)17/h2-6,16-17H,1H3 |
| InChIKey | RVORFCSMSPBCTG-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|