About S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate
S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate (PubChem CID 57290949) has the molecular formula C7H10N6OS
and a molecular weight of 226.27 g/mol. Its IUPAC name is S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate.
Molecular Properties
| Compound Name | S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate |
| PubChem CID | 57290949 |
| Molecular Formula | C7H10N6OS |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate |
| SMILES | CN1C2=NC=NC2=CN(SC(N)=O)C1N |
| InChI | InChI=1S/C7H10N6OS/c1-12-5-4(10-3-11-5)2-13(6(12)8)15-7(9)14/h2-3,6H,8H2,1H3,(H2,9,14) |
| InChIKey | FCZMNWZDLLUDQS-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate?
The IUPAC name of S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate (CID 57290949) is S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate.
What is the SMILES notation for S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate?
The canonical SMILES for S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate is CN1C2=NC=NC2=CN(SC(N)=O)C1N.
What is the InChIKey of S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate?
The InChIKey is FCZMNWZDLLUDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6OS/c1-12-5-4(10-3-11-5)2-13(6(12)8)15-7(9)14/h2-3,6H,8H2,1H3,(H2,9,14).
What are the key properties of S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate?
S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate has a molecular weight of 226.27 g/mol, XLogP of -0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2-amino-3-methyl-2H-purin-1-yl)] carbamothioate is sourced from PubChem (CID 57290949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).