C7H10N4O — CID 91219653
1,3-dimethyl-7,8-dihydropurin-2-one (PubChem CID 91219653) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 1,3-dimethyl-7,8-dihydropurin-2-one.
| Compound Name | 1,3-dimethyl-7,8-dihydropurin-2-one |
|---|---|
| PubChem CID | 91219653 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1,3-dimethyl-7,8-dihydropurin-2-one |
| SMILES | CN1C=C2NCN=C2N(C)C1=O |
| InChI | InChI=1S/C7H10N4O/c1-10-3-5-6(9-4-8-5)11(2)7(10)12/h3,8H,4H2,1-2H3 |
| InChIKey | JMMUEUQPNMRBIV-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |