C20H14F2N2O — CID 57291935
1-[(2,4-difluorophenyl)-(5-phenylfuran-2-yl)methyl]imidazole (PubChem CID 57291935) has the molecular formula C20H14F2N2O and a molecular weight of 336.34 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)-(5-phenylfuran-2-yl)methyl]imidazole.
| Compound Name | 1-[(2,4-difluorophenyl)-(5-phenylfuran-2-yl)methyl]imidazole |
|---|---|
| PubChem CID | 57291935 |
| Molecular Formula | C20H14F2N2O |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-[(2,4-difluorophenyl)-(5-phenylfuran-2-yl)methyl]imidazole |
| SMILES | Fc1ccc(C(c2ccc(-c3ccccc3)o2)n2ccnc2)c(F)c1 |
| InChI | InChI=1S/C20H14F2N2O/c21-15-6-7-16(17(22)12-15)20(24-11-10-23-13-24)19-9-8-18(25-19)14-4-2-1-3-5-14/h1-13,20H |
| InChIKey | KZXLSNUMNZFMNZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |