C22H39FO4 — CID 57291949
trans-(2R,3R)-2-(7,8-dihydroxyoctyl)-3-[4-(fluoromethyl)-4-hydroxyoct-1-enyl]cyclopentan-1-one (PubChem CID 57291949) has the molecular formula C22H39FO4 and a molecular weight of 386.55 g/mol. Its IUPAC name is trans-(2R,3R)-2-(7,8-dihydroxyoctyl)-3-[4-(fluoromethyl)-4-hydroxyoct-1-enyl]cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-2-(7,8-dihydroxyoctyl)-3-[4-(fluoromethyl)-4-hydroxyoct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 57291949 |
| Molecular Formula | C22H39FO4 |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | trans-(2R,3R)-2-(7,8-dihydroxyoctyl)-3-[4-(fluoromethyl)-4-hydroxyoct-1-enyl]cyclopentan-1-one |
| SMILES | CCCCC(O)(CF)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCCC(O)CO |
| InChI | InChI=1S/C22H39FO4/c1-2-3-14-22(27,17-23)15-8-9-18-12-13-21(26)20(18)11-7-5-4-6-10-19(25)16-24/h8-9,18-20,24-25,27H,2-7,10-17H2,1H3/t18-,19?,20+,22?/m0/s1 |
| InChIKey | OPXXCJPDEPTUOP-SFHMGJLPSA-N |
| XLogP | 4.11 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|