C20H25N3O5S — CID 57292178
5-methoxy-15-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)-12-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,13-dione (PubChem CID 57292178) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 5-methoxy-15-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)-12-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,13-dione.
| Compound Name | 5-methoxy-15-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)-12-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,13-dione |
|---|---|
| PubChem CID | 57292178 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 5-methoxy-15-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)-12-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,13-dione |
| SMILES | COC1(c2nc(C)no2)CSCc2cccc(C)c2C(=O)OCCCCC(=O)N1 |
| InChI | InChI=1S/C20H25N3O5S/c1-13-7-6-8-15-11-29-12-20(26-3,19-21-14(2)23-28-19)22-16(24)9-4-5-10-27-18(25)17(13)15/h6-8H,4-5,9-12H2,1-3H3,(H,22,24) |
| InChIKey | NOKGWWJNZIEFHO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |