C15H14O2 — CID 57292646
1-(3-hydroxyphenyl)-2,3-dihydroinden-1-ol (PubChem CID 57292646) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-(3-hydroxyphenyl)-2,3-dihydroinden-1-ol.
| Compound Name | 1-(3-hydroxyphenyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 57292646 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-(3-hydroxyphenyl)-2,3-dihydroinden-1-ol |
| SMILES | Oc1cccc(C2(O)CCc3ccccc32)c1 |
| InChI | InChI=1S/C15H14O2/c16-13-6-3-5-12(10-13)15(17)9-8-11-4-1-2-7-14(11)15/h1-7,10,16-17H,8-9H2 |
| InChIKey | NCPIOIDAJMRPAT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |