About 2-oxopyran-3-sulfinate
2-oxopyran-3-sulfinate (PubChem CID 57296057) has the molecular formula C5H3O4S-
and a molecular weight of 159.14 g/mol. Its IUPAC name is 2-oxopyran-3-sulfinate.
Molecular Properties
| Compound Name | 2-oxopyran-3-sulfinate |
| PubChem CID | 57296057 |
| Molecular Formula | C5H3O4S- |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 158.98 |
| IUPAC Name | 2-oxopyran-3-sulfinate |
| SMILES | O=c1occcc1S(=O)[O-] |
| InChI | InChI=1S/C5H4O4S/c6-5-4(10(7)8)2-1-3-9-5/h1-3H,(H,7,8)/p-1 |
| InChIKey | QQXCABIRDFTBTL-UHFFFAOYSA-M |
| XLogP | -0.12 |
| TPSA | 70.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopyran-3-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopyran-3-sulfinate?
The IUPAC name of 2-oxopyran-3-sulfinate (CID 57296057) is 2-oxopyran-3-sulfinate.
What is the SMILES notation for 2-oxopyran-3-sulfinate?
The canonical SMILES for 2-oxopyran-3-sulfinate is O=c1occcc1S(=O)[O-].
What is the InChIKey of 2-oxopyran-3-sulfinate?
The InChIKey is QQXCABIRDFTBTL-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4O4S/c6-5-4(10(7)8)2-1-3-9-5/h1-3H,(H,7,8)/p-1.
What are the key properties of 2-oxopyran-3-sulfinate?
2-oxopyran-3-sulfinate has a molecular weight of 159.14 g/mol, XLogP of -0.12, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopyran-3-sulfinate is sourced from PubChem (CID 57296057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).