About 2-oxopyran-3-sulfinic acid
2-oxopyran-3-sulfinic acid (PubChem CID 57296058) has the molecular formula C5H4O4S
and a molecular weight of 160.15 g/mol. Its IUPAC name is 2-oxopyran-3-sulfinic acid.
Molecular Properties
| Compound Name | 2-oxopyran-3-sulfinic acid |
| PubChem CID | 57296058 |
| Molecular Formula | C5H4O4S |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 159.98 |
| IUPAC Name | 2-oxopyran-3-sulfinic acid |
| SMILES | O=c1occcc1S(=O)O |
| InChI | InChI=1S/C5H4O4S/c6-5-4(10(7)8)2-1-3-9-5/h1-3H,(H,7,8) |
| InChIKey | QQXCABIRDFTBTL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopyran-3-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopyran-3-sulfinic acid?
The IUPAC name of 2-oxopyran-3-sulfinic acid (CID 57296058) is 2-oxopyran-3-sulfinic acid.
What is the SMILES notation for 2-oxopyran-3-sulfinic acid?
The canonical SMILES for 2-oxopyran-3-sulfinic acid is O=c1occcc1S(=O)O.
What is the InChIKey of 2-oxopyran-3-sulfinic acid?
The InChIKey is QQXCABIRDFTBTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O4S/c6-5-4(10(7)8)2-1-3-9-5/h1-3H,(H,7,8).
What are the key properties of 2-oxopyran-3-sulfinic acid?
2-oxopyran-3-sulfinic acid has a molecular weight of 160.15 g/mol, XLogP of 0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopyran-3-sulfinic acid is sourced from PubChem (CID 57296058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).