C28H24F30O4 — CID 57297894
2-[3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxymethyl)-3-methyloxetan-2-yl]-3-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)oxetane (PubChem CID 57297894) has the molecular formula C28H24F30O4 and a molecular weight of 994.44 g/mol. Its IUPAC name is 2-[3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxymethyl)-3-methyloxetan-2-yl]-3-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)oxetane.
| Compound Name | 2-[3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxymethyl)-3-methyloxetan-2-yl]-3-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)oxetane |
|---|---|
| PubChem CID | 57297894 |
| Molecular Formula | C28H24F30O4 |
| Molecular Weight | 994.44 g/mol |
| Exact Mass | 994.12 |
| IUPAC Name | 2-[3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxymethyl)-3-methyloxetan-2-yl]-3-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)oxetane |
| SMILES | CC1(COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)COC1C1OCC1(C)COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C28H24F30O4/c1-13(7-59-5-3-15(29,30)17(33,34)19(37,38)21(41,42)22(43,44)24(47,48)26(51,52)28(56,57)58)9-61-11(13)12-14(2,10-62-12)8-60-6-4-16(31,32)18(35,36)20(39,40)23(45,46)25(49,50)27(53,54)55/h11-12H,3-10H2,1-2H3 |
| InChIKey | ACCVVZZLXOZRBZ-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.44 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|