C15H14F16O3 — CID 18405884
3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)-3-(2,2,2-trifluoroethoxymethyl)oxetane (PubChem CID 18405884) has the molecular formula C15H14F16O3 and a molecular weight of 546.24 g/mol. Its IUPAC name is 3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)-3-(2,2,2-trifluoroethoxymethyl)oxetane.
| Compound Name | 3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)-3-(2,2,2-trifluoroethoxymethyl)oxetane |
|---|---|
| PubChem CID | 18405884 |
| Molecular Formula | C15H14F16O3 |
| Molecular Weight | 546.24 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | 3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)-3-(2,2,2-trifluoroethoxymethyl)oxetane |
| SMILES | FC(F)(F)COCC1(COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)COC1 |
| InChI | InChI=1S/C15H14F16O3/c16-9(17,1-2-32-3-8(4-33-5-8)6-34-7-10(18,19)20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)31/h1-7H2 |
| InChIKey | QZWGMRVFXXXPPC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.24 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|