About (4-pyridin-3-ylphenyl) sulfite
(4-pyridin-3-ylphenyl) sulfite (PubChem CID 57298319) has the molecular formula C11H8NO3S-
and a molecular weight of 234.26 g/mol. Its IUPAC name is (4-pyridin-3-ylphenyl) sulfite.
Molecular Properties
| Compound Name | (4-pyridin-3-ylphenyl) sulfite |
| PubChem CID | 57298319 |
| Molecular Formula | C11H8NO3S- |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | (4-pyridin-3-ylphenyl) sulfite |
| SMILES | O=S([O-])Oc1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C11H9NO3S/c13-16(14)15-11-5-3-9(4-6-11)10-2-1-7-12-8-10/h1-8H,(H,13,14)/p-1 |
| InChIKey | ZEEJHGFBJQEILV-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (4-pyridin-3-ylphenyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pyridin-3-ylphenyl) sulfite?
The IUPAC name of (4-pyridin-3-ylphenyl) sulfite (CID 57298319) is (4-pyridin-3-ylphenyl) sulfite.
What is the SMILES notation for (4-pyridin-3-ylphenyl) sulfite?
The canonical SMILES for (4-pyridin-3-ylphenyl) sulfite is O=S([O-])Oc1ccc(-c2cccnc2)cc1.
What is the InChIKey of (4-pyridin-3-ylphenyl) sulfite?
The InChIKey is ZEEJHGFBJQEILV-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H9NO3S/c13-16(14)15-11-5-3-9(4-6-11)10-2-1-7-12-8-10/h1-8H,(H,13,14)/p-1.
What are the key properties of (4-pyridin-3-ylphenyl) sulfite?
(4-pyridin-3-ylphenyl) sulfite has a molecular weight of 234.26 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pyridin-3-ylphenyl) sulfite is sourced from PubChem (CID 57298319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).