C29H32N6O7 — CID 57302152
[2,6-dimethyl-4-(2-nitrophenyl)-3-(1,3,4-oxadiazol-2-yl)-3,4-dihydropyridin-5-yl] 2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl carbonate (PubChem CID 57302152) has the molecular formula C29H32N6O7 and a molecular weight of 576.61 g/mol. Its IUPAC name is [2,6-dimethyl-4-(2-nitrophenyl)-3-(1,3,4-oxadiazol-2-yl)-3,4-dihydropyridin-5-yl] 2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl carbonate.
| Compound Name | [2,6-dimethyl-4-(2-nitrophenyl)-3-(1,3,4-oxadiazol-2-yl)-3,4-dihydropyridin-5-yl] 2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl carbonate |
|---|---|
| PubChem CID | 57302152 |
| Molecular Formula | C29H32N6O7 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | [2,6-dimethyl-4-(2-nitrophenyl)-3-(1,3,4-oxadiazol-2-yl)-3,4-dihydropyridin-5-yl] 2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl carbonate |
| SMILES | COc1ccccc1N1CCN(CCOC(=O)OC2=C(C)N=C(C)C(c3nnco3)C2c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C29H32N6O7/c1-19-25(28-32-30-18-41-28)26(21-8-4-5-9-22(21)35(37)38)27(20(2)31-19)42-29(36)40-17-16-33-12-14-34(15-13-33)23-10-6-7-11-24(23)39-3/h4-11,18,25-26H,12-17H2,1-3H3 |
| InChIKey | RBFGVTTWYVPACF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 145.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|