C37H39N5O7 — CID 54364519
[2,6-dimethyl-4-(3-nitrophenyl)-3-(1,3,4-oxadiazol-2-yl)-3,4-dihydropyridin-5-yl] 2-[2-(4,4-diphenylpiperidin-1-yl)ethoxy]ethyl carbonate (PubChem CID 54364519) has the molecular formula C37H39N5O7 and a molecular weight of 665.75 g/mol. Its IUPAC name is [2,6-dimethyl-4-(3-nitrophenyl)-3-(1,3,4-oxadiazol-2-yl)-3,4-dihydropyridin-5-yl] 2-[2-(4,4-diphenylpiperidin-1-yl)ethoxy]ethyl carbonate.
| Compound Name | [2,6-dimethyl-4-(3-nitrophenyl)-3-(1,3,4-oxadiazol-2-yl)-3,4-dihydropyridin-5-yl] 2-[2-(4,4-diphenylpiperidin-1-yl)ethoxy]ethyl carbonate |
|---|---|
| PubChem CID | 54364519 |
| Molecular Formula | C37H39N5O7 |
| Molecular Weight | 665.75 g/mol |
| Exact Mass | 665.28 |
| IUPAC Name | [2,6-dimethyl-4-(3-nitrophenyl)-3-(1,3,4-oxadiazol-2-yl)-3,4-dihydropyridin-5-yl] 2-[2-(4,4-diphenylpiperidin-1-yl)ethoxy]ethyl carbonate |
| SMILES | CC1=NC(C)=C(OC(=O)OCCOCCN2CCC(c3ccccc3)(c3ccccc3)CC2)C(c2cccc([N+](=O)[O-])c2)C1c1nnco1 |
| InChI | InChI=1S/C37H39N5O7/c1-26-32(35-40-38-25-48-35)33(28-10-9-15-31(24-28)42(44)45)34(27(2)39-26)49-36(43)47-23-22-46-21-20-41-18-16-37(17-19-41,29-11-5-3-6-12-29)30-13-7-4-8-14-30/h3-15,24-25,32-33H,16-23H2,1-2H3 |
| InChIKey | UOVLILYLXXPGJT-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 142.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|