C31H44N2O4S — CID 57302767
7-but-3-enyl-8,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 57302767) has the molecular formula C31H44N2O4S and a molecular weight of 540.77 g/mol. Its IUPAC name is 7-but-3-enyl-8,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | 7-but-3-enyl-8,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 57302767 |
| Molecular Formula | C31H44N2O4S |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 7-but-3-enyl-8,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | C=CCCC1C(=O)C(C)(C)CCC(=O)NC(c2ccc3sc(C)nc3c2)CC=C(C)CCCC(C)C1(O)O |
| InChI | InChI=1S/C31H44N2O4S/c1-7-8-12-24-29(35)30(5,6)18-17-28(34)33-25(23-14-16-27-26(19-23)32-22(4)38-27)15-13-20(2)10-9-11-21(3)31(24,36)37/h7,13-14,16,19,21,24-25,36-37H,1,8-12,15,17-18H2,2-6H3,(H,33,34) |
| InChIKey | NKDDXJOTYBREBE-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|