C27H35FN2O4S — CID 142001512
[(1R,5R,16R)-5,14,16-trimethyl-9-(2-methyl-1,3-benzothiazol-5-yl)-11,15-dioxo-6-oxa-10-azatricyclo[12.3.1.05,7]octadecan-17-yl] hypofluorite (PubChem CID 142001512) has the molecular formula C27H35FN2O4S and a molecular weight of 502.65 g/mol. Its IUPAC name is [(1R,5R,16R)-5,14,16-trimethyl-9-(2-methyl-1,3-benzothiazol-5-yl)-11,15-dioxo-6-oxa-10-azatricyclo[12.3.1.05,7]octadecan-17-yl] hypofluorite.
| Compound Name | [(1R,5R,16R)-5,14,16-trimethyl-9-(2-methyl-1,3-benzothiazol-5-yl)-11,15-dioxo-6-oxa-10-azatricyclo[12.3.1.05,7]octadecan-17-yl] hypofluorite |
|---|---|
| PubChem CID | 142001512 |
| Molecular Formula | C27H35FN2O4S |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | [(1R,5R,16R)-5,14,16-trimethyl-9-(2-methyl-1,3-benzothiazol-5-yl)-11,15-dioxo-6-oxa-10-azatricyclo[12.3.1.05,7]octadecan-17-yl] hypofluorite |
| SMILES | Cc1nc2cc(C3CC4O[C@]4(C)CCC[C@@H]4CC(C)(CCC(=O)N3)C(=O)[C@H](C)C4OF)ccc2s1 |
| InChI | InChI=1S/C27H35FN2O4S/c1-15-24(34-28)18-6-5-10-27(4)22(33-27)13-19(17-7-8-21-20(12-17)29-16(2)35-21)30-23(31)9-11-26(3,14-18)25(15)32/h7-8,12,15,18-19,22,24H,5-6,9-11,13-14H2,1-4H3,(H,30,31)/t15-,18-,19?,22?,24?,26?,27-/m1/s1 |
| InChIKey | RRXDTLABXOOITO-VMOWWQAZSA-N |
| XLogP | 5.77 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|